C28H39N3OS — CID 46862831
N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazol-4-yl]acetamide (PubChem CID 46862831) has the molecular formula C28H39N3OS and a molecular weight of 465.71 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 46862831 |
| Molecular Formula | C28H39N3OS |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N-(1-adamantyl)-2-[2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1cs/c(=N\C23CC4CC(CC(C4)C2)C3)n1C1CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H39N3OS/c32-25(29-27-10-17-3-18(11-27)5-19(4-17)12-27)9-24-16-33-26(31(24)23-1-2-23)30-28-13-20-6-21(14-28)8-22(7-20)15-28/h16-23H,1-15H2,(H,29,32)/b30-26- |
| InChIKey | XZGJARRPRQPMMD-BXVZCJGGSA-N |
| XLogP | 5.38 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|