C20H27NO5 — CID 46862603
dimethyl 2-[[(1S,3aS,5R,7aS)-7a-(2-cyanoethyl)-5-methyl-2-methylidene-7-oxo-1,3,3a,4,5,6-hexahydroinden-1-yl]methyl]propanedioate (PubChem CID 46862603) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is dimethyl 2-[[(1S,3aS,5R,7aS)-7a-(2-cyanoethyl)-5-methyl-2-methylidene-7-oxo-1,3,3a,4,5,6-hexahydroinden-1-yl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[(1S,3aS,5R,7aS)-7a-(2-cyanoethyl)-5-methyl-2-methylidene-7-oxo-1,3,3a,4,5,6-hexahydroinden-1-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 46862603 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | dimethyl 2-[[(1S,3aS,5R,7aS)-7a-(2-cyanoethyl)-5-methyl-2-methylidene-7-oxo-1,3,3a,4,5,6-hexahydroinden-1-yl]methyl]propanedioate |
| SMILES | C=C1C[C@@H]2C[C@@H](C)CC(=O)[C@]2(CCC#N)[C@H]1CC(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H27NO5/c1-12-8-14-10-13(2)16(11-15(18(23)25-3)19(24)26-4)20(14,6-5-7-21)17(22)9-12/h12,14-16H,2,5-6,8-11H2,1,3-4H3/t12-,14+,16+,20+/m1/s1 |
| InChIKey | YUWFWQKTGBVYIK-XNGSYYAWSA-N |
| XLogP | 2.82 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|