C17H23NO4 — CID 11034086
diethyl (3aR,4S,7aR)-4-cyano-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate (PubChem CID 11034086) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is diethyl (3aR,4S,7aR)-4-cyano-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | diethyl (3aR,4S,7aR)-4-cyano-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11034086 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | diethyl (3aR,4S,7aR)-4-cyano-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)[C@@H]2CCC[C@H](C#N)[C@H]12 |
| InChI | InChI=1S/C17H23NO4/c1-4-21-15(19)17(16(20)22-5-2)9-11(3)14-12(10-18)7-6-8-13(14)17/h12-14H,3-9H2,1-2H3/t12-,13-,14+/m1/s1 |
| InChIKey | OWYWNTICSRCJOR-MCIONIFRSA-N |
| XLogP | 2.61 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|