C29H49NO4Sn — CID 10841197
dimethyl (4E)-3-(4-cyano-2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 10841197) has the molecular formula C29H49NO4Sn and a molecular weight of 594.43 g/mol. Its IUPAC name is dimethyl (4E)-3-(4-cyano-2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-(4-cyano-2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10841197 |
| Molecular Formula | C29H49NO4Sn |
| Molecular Weight | 594.43 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | dimethyl (4E)-3-(4-cyano-2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(C#N)CC(C)(C)C1CC(C(=O)OC)(C(=O)OC)C/C1=C\[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C17H22NO4.3C4H9.Sn/c1-11(10-18)7-16(3,4)13-9-17(8-12(13)2,14(19)21-5)15(20)22-6;3*1-3-4-2;/h2,13H,1,7-9H2,3-6H3;3*1,3-4H2,2H3; |
| InChIKey | UANQSZVLWJCFPU-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.43 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|