C17H20N2O4 — CID 50900165
diethyl 5,6-dicyano-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate (PubChem CID 50900165) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is diethyl 5,6-dicyano-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 5,6-dicyano-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 50900165 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | diethyl 5,6-dicyano-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2C=C(C#N)C(C#N)CC2C1 |
| InChI | InChI=1S/C17H20N2O4/c1-3-22-15(20)17(16(21)23-4-2)7-11-5-13(9-18)14(10-19)6-12(11)8-17/h5,11-12,14H,3-4,6-8H2,1-2H3 |
| InChIKey | NFUPCDHJAARACH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|