C16H20N2O4 — CID 135021295
diethyl (3Z)-4-(cyanomethyl)-3-(cyanomethylidene)cyclohexane-1,1-dicarboxylate (PubChem CID 135021295) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is diethyl (3Z)-4-(cyanomethyl)-3-(cyanomethylidene)cyclohexane-1,1-dicarboxylate.
| Compound Name | diethyl (3Z)-4-(cyanomethyl)-3-(cyanomethylidene)cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135021295 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | diethyl (3Z)-4-(cyanomethyl)-3-(cyanomethylidene)cyclohexane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(CC#N)/C(=C\C#N)C1 |
| InChI | InChI=1S/C16H20N2O4/c1-3-21-14(19)16(15(20)22-4-2)8-5-12(6-9-17)13(11-16)7-10-18/h7,12H,3-6,8,11H2,1-2H3/b13-7- |
| InChIKey | SPBFZGOBNITRRP-QPEQYQDCSA-N |
| XLogP | 2.26 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|