C27H37NO6 — CID 10390033
methyl (1R,3aR,7S)-4-cyano-7-[(E)-hept-1-enyl]-1-[(Z)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4-carboxylate (PubChem CID 10390033) has the molecular formula C27H37NO6 and a molecular weight of 471.59 g/mol. Its IUPAC name is methyl (1R,3aR,7S)-4-cyano-7-[(E)-hept-1-enyl]-1-[(Z)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4-carboxylate.
| Compound Name | methyl (1R,3aR,7S)-4-cyano-7-[(E)-hept-1-enyl]-1-[(Z)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 10390033 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | methyl (1R,3aR,7S)-4-cyano-7-[(E)-hept-1-enyl]-1-[(Z)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4-carboxylate |
| SMILES | CCCCC/C=C/C1CC(=O)C(C#N)(C(=O)OC)[C@@H]2CC(=O)[C@H](C/C=C\CCCC(=O)OC)C12 |
| InChI | InChI=1S/C27H37NO6/c1-4-5-6-7-10-13-19-16-23(30)27(18-28,26(32)34-3)21-17-22(29)20(25(19)21)14-11-8-9-12-15-24(31)33-2/h8,10-11,13,19-21,25H,4-7,9,12,14-17H2,1-3H3/b11-8-,13-10+/t19?,20-,21+,25?,27?/m0/s1 |
| InChIKey | JJXSPIDOCLMRGH-BADYRXRNSA-N |
| XLogP | 4.51 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|