C22H31NO4 — CID 67685420
methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methoxy-5-methyl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 67685420) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methoxy-5-methyl-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methoxy-5-methyl-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 67685420 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methoxy-5-methyl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1C[C@](C)(C2CC[C@]3(C)CCC[C@H]3C2CC#N)C(OC)=CC1=O |
| InChI | InChI=1S/C22H31NO4/c1-21-9-5-6-16(21)14(8-11-23)17(7-10-21)22(2)13-15(20(25)27-4)18(24)12-19(22)26-3/h12,14-17H,5-10,13H2,1-4H3/t14?,15?,16-,17?,21-,22+/m0/s1 |
| InChIKey | DKNWXNUXTMXERW-VNIKEEFQSA-N |
| XLogP | 4.03 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|