C29H34Cl2N2O2 — CID 91204322
(8S,9R,10R,13S,14S)-N-(2,6-dichloro-4-cyanophenyl)-4,6,10,13-tetramethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxamide (PubChem CID 91204322) has the molecular formula C29H34Cl2N2O2 and a molecular weight of 513.51 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-N-(2,6-dichloro-4-cyanophenyl)-4,6,10,13-tetramethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxamide.
| Compound Name | (8S,9R,10R,13S,14S)-N-(2,6-dichloro-4-cyanophenyl)-4,6,10,13-tetramethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 91204322 |
| Molecular Formula | C29H34Cl2N2O2 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (8S,9R,10R,13S,14S)-N-(2,6-dichloro-4-cyanophenyl)-4,6,10,13-tetramethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxamide |
| SMILES | CC1=C2C(C)C(=O)C(C(=O)Nc3c(Cl)cc(C#N)cc3Cl)C[C@]2(C)[C@@H]2CC[C@]3(C)CCC[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C29H34Cl2N2O2/c1-15-10-18-20-6-5-8-28(20,3)9-7-21(18)29(4)13-19(26(34)16(2)24(15)29)27(35)33-25-22(30)11-17(14-32)12-23(25)31/h11-12,16,18-21H,5-10,13H2,1-4H3,(H,33,35)/t16?,18-,19?,20-,21+,28-,29+/m0/s1 |
| InChIKey | OTSFFGNSXGBITQ-KRAQRMFJSA-N |
| XLogP | 7.59 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|