C27H44N2O2 — CID 67873072
(3aS,3bS,9aR,9bR,11aS)-5-butyl-N,N-diethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-8-carboxamide (PubChem CID 67873072) has the molecular formula C27H44N2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-5-butyl-N,N-diethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-8-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-5-butyl-N,N-diethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-8-carboxamide |
|---|---|
| PubChem CID | 67873072 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-5-butyl-N,N-diethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-8-carboxamide |
| SMILES | CCCCN1C[C@@H]2[C@@H](CC[C@]3(C)CCC[C@@H]23)[C@@]2(C)CC(C(=O)N(CC)CC)C(=O)C=C12 |
| InChI | InChI=1S/C27H44N2O2/c1-6-9-15-29-18-20-21-11-10-13-26(21,4)14-12-22(20)27(5)17-19(23(30)16-24(27)29)25(31)28(7-2)8-3/h16,19-22H,6-15,17-18H2,1-5H3/t19?,20-,21-,22+,26-,27+/m0/s1 |
| InChIKey | PGSBMAFMSSVZGB-CRBVVKRISA-N |
| XLogP | 5.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|