C23H35N3O2S — CID 67746554
(3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-N-thiomorpholin-4-yl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide (PubChem CID 67746554) has the molecular formula C23H35N3O2S and a molecular weight of 417.62 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-N-thiomorpholin-4-yl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-N-thiomorpholin-4-yl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide |
|---|---|
| PubChem CID | 67746554 |
| Molecular Formula | C23H35N3O2S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-N-thiomorpholin-4-yl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CN(C(=O)NN3CCSCC3)C3=CC(=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C23H35N3O2S/c1-22-7-3-4-18(22)17-15-26(21(28)24-25-10-12-29-13-11-25)20-14-16(27)5-9-23(20,2)19(17)6-8-22/h14,17-19H,3-13,15H2,1-2H3,(H,24,28)/t17-,18-,19-,22-,23+/m0/s1 |
| InChIKey | VYGUHRJMKCXFGO-CTOYRMGLSA-N |
| XLogP | 4.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |