C32H36Cl2N2O2 — CID 67653333
(3aS,3bS,9aR,9bS,11aS)-N-[bis(4-chlorophenyl)methyl]-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide (PubChem CID 67653333) has the molecular formula C32H36Cl2N2O2 and a molecular weight of 551.56 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aS)-N-[bis(4-chlorophenyl)methyl]-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bS,11aS)-N-[bis(4-chlorophenyl)methyl]-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide |
|---|---|
| PubChem CID | 67653333 |
| Molecular Formula | C32H36Cl2N2O2 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aS)-N-[bis(4-chlorophenyl)methyl]-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CN(C(=O)NC(c3ccc(Cl)cc3)c3ccc(Cl)cc3)C3=CC(=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C32H36Cl2N2O2/c1-31-15-3-4-26(31)25-19-36(28-18-24(37)13-17-32(28,2)27(25)14-16-31)30(38)35-29(20-5-9-22(33)10-6-20)21-7-11-23(34)12-8-21/h5-12,18,25-27,29H,3-4,13-17,19H2,1-2H3,(H,35,38)/t25-,26-,27-,31-,32+/m0/s1 |
| InChIKey | NGFCBLVBRPJIDQ-YOLJOIBXSA-N |
| XLogP | 8.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |