C29H39BrN2O2 — CID 22881144
(3aS,3bS,9aR,9bS,11aS)-N-(4-bromo-2-tert-butylphenyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide (PubChem CID 22881144) has the molecular formula C29H39BrN2O2 and a molecular weight of 527.55 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aS)-N-(4-bromo-2-tert-butylphenyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bS,11aS)-N-(4-bromo-2-tert-butylphenyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide |
|---|---|
| PubChem CID | 22881144 |
| Molecular Formula | C29H39BrN2O2 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aS)-N-(4-bromo-2-tert-butylphenyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxamide |
| SMILES | CC(C)(C)c1cc(Br)ccc1NC(=O)N1C[C@H]2[C@@H]3CCC[C@@]3(C)CC[C@@H]2[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C29H39BrN2O2/c1-27(2,3)23-15-18(30)8-9-24(23)31-26(34)32-17-20-21-7-6-12-28(21,4)13-11-22(20)29(5)14-10-19(33)16-25(29)32/h8-9,15-16,20-22H,6-7,10-14,17H2,1-5H3,(H,31,34)/t20-,21-,22-,28-,29+/m0/s1 |
| InChIKey | ISJJIWVRPMWEFO-CBTDEICWSA-N |
| XLogP | 7.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |