C28H40O8 — CID 42622315
dimethyl (3aR,7S)-7-[(Z)-hept-1-enyl]-1-[(E)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4,4-dicarboxylate (PubChem CID 42622315) has the molecular formula C28H40O8 and a molecular weight of 504.62 g/mol. Its IUPAC name is dimethyl (3aR,7S)-7-[(Z)-hept-1-enyl]-1-[(E)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4,4-dicarboxylate.
| Compound Name | dimethyl (3aR,7S)-7-[(Z)-hept-1-enyl]-1-[(E)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4,4-dicarboxylate |
|---|---|
| PubChem CID | 42622315 |
| Molecular Formula | C28H40O8 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | dimethyl (3aR,7S)-7-[(Z)-hept-1-enyl]-1-[(E)-7-methoxy-7-oxohept-2-enyl]-2,5-dioxo-1,3,3a,6,7,7a-hexahydroindene-4,4-dicarboxylate |
| SMILES | CCCCC/C=C\C1CC(=O)C(C(=O)OC)(C(=O)OC)[C@@H]2CC(=O)C(C/C=C/CCCC(=O)OC)C12 |
| InChI | InChI=1S/C28H40O8/c1-5-6-7-8-11-14-19-17-23(30)28(26(32)35-3,27(33)36-4)21-18-22(29)20(25(19)21)15-12-9-10-13-16-24(31)34-2/h9,11-12,14,19-21,25H,5-8,10,13,15-18H2,1-4H3/b12-9+,14-11-/t19?,20?,21-,25?/m1/s1 |
| InChIKey | MBJMBZYXTHOOFU-YHPCOSMOSA-N |
| XLogP | 4.16 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|