C24H30O8 — CID 11134082
trimethyl (5R,8S,9R,10S,13R,14S)-10-methyl-11,17-dioxo-1,2,4,5,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,3,13-tricarboxylate (PubChem CID 11134082) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is trimethyl (5R,8S,9R,10S,13R,14S)-10-methyl-11,17-dioxo-1,2,4,5,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,3,13-tricarboxylate.
| Compound Name | trimethyl (5R,8S,9R,10S,13R,14S)-10-methyl-11,17-dioxo-1,2,4,5,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,3,13-tricarboxylate |
|---|---|
| PubChem CID | 11134082 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | trimethyl (5R,8S,9R,10S,13R,14S)-10-methyl-11,17-dioxo-1,2,4,5,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,3,13-tricarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@]2(C)[C@@H]3C(=O)C[C@]4(C(=O)OC)C(=O)CC[C@H]4[C@@H]3C=C[C@H]2C1 |
| InChI | InChI=1S/C24H30O8/c1-22-9-10-23(19(27)30-2,20(28)31-3)11-13(22)5-6-14-15-7-8-17(26)24(15,21(29)32-4)12-16(25)18(14)22/h5-6,13-15,18H,7-12H2,1-4H3/t13-,14-,15-,18-,22-,24+/m0/s1 |
| InChIKey | HEOHVCQQLRRBTP-MOPKIBDLSA-N |
| XLogP | 2.04 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|