C26H37NO — CID 46862607
(6Z,9Z,12Z,15Z)-1-(2-phenylethylamino)octadeca-6,9,12,15-tetraen-3-one (PubChem CID 46862607) has the molecular formula C26H37NO and a molecular weight of 379.59 g/mol. Its IUPAC name is (6Z,9Z,12Z,15Z)-1-(2-phenylethylamino)octadeca-6,9,12,15-tetraen-3-one.
| Compound Name | (6Z,9Z,12Z,15Z)-1-(2-phenylethylamino)octadeca-6,9,12,15-tetraen-3-one |
|---|---|
| PubChem CID | 46862607 |
| Molecular Formula | C26H37NO |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | (6Z,9Z,12Z,15Z)-1-(2-phenylethylamino)octadeca-6,9,12,15-tetraen-3-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)CCNCCc1ccccc1 |
| InChI | InChI=1S/C26H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-26(28)22-24-27-23-21-25-18-15-14-16-19-25/h3-4,6-7,9-10,12-16,18-19,27H,2,5,8,11,17,20-24H2,1H3/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | MYIWPLUHRJABDK-LTKCOYKYSA-N |
| XLogP | 6.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|