C23H33NO7 — CID 46865129
[(3S,3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-(morpholin-4-ylmethyl)-2,9-dioxo-3a,4,5,11a-tetrahydro-3H-cyclodeca[b]furan-4-yl] 2-methylpropanoate (PubChem CID 46865129) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is [(3S,3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-(morpholin-4-ylmethyl)-2,9-dioxo-3a,4,5,11a-tetrahydro-3H-cyclodeca[b]furan-4-yl] 2-methylpropanoate.
| Compound Name | [(3S,3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-(morpholin-4-ylmethyl)-2,9-dioxo-3a,4,5,11a-tetrahydro-3H-cyclodeca[b]furan-4-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 46865129 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | [(3S,3aR,4R,6R,7E,10Z,11aR)-6-hydroxy-6,10-dimethyl-3-(morpholin-4-ylmethyl)-2,9-dioxo-3a,4,5,11a-tetrahydro-3H-cyclodeca[b]furan-4-yl] 2-methylpropanoate |
| SMILES | C/C1=C/[C@H]2OC(=O)[C@H](CN3CCOCC3)[C@@H]2[C@H](OC(=O)C(C)C)C[C@@](C)(O)/C=C/C1=O |
| InChI | InChI=1S/C23H33NO7/c1-14(2)21(26)31-19-12-23(4,28)6-5-17(25)15(3)11-18-20(19)16(22(27)30-18)13-24-7-9-29-10-8-24/h5-6,11,14,16,18-20,28H,7-10,12-13H2,1-4H3/b6-5+,15-11-/t16-,18-,19-,20+,23+/m1/s1 |
| InChIKey | FAZPQWYGMVBMHY-UGYYYRRYSA-N |
| XLogP | 1.27 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |