C17H10N4O — CID 46866334
2-(furan-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 46866334) has the molecular formula C17H10N4O and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-(furan-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-(furan-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 46866334 |
| Molecular Formula | C17H10N4O |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(furan-2-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1coc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c1 |
| InChI | InChI=1S/C17H10N4O/c1-4-10-13(18-7-1)14-11(5-2-8-19-14)16-15(10)20-17(21-16)12-6-3-9-22-12/h1-9H,(H,20,21) |
| InChIKey | INIWRQBVYVQRJZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|