C29H26N4O5 — CID 46868024
3-[1-[5-(benzylamino)-5-oxopentyl]triazol-4-yl]-6-hydroxy-2-phenyl-1-benzofuran-5-carboxylic acid (PubChem CID 46868024) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is 3-[1-[5-(benzylamino)-5-oxopentyl]triazol-4-yl]-6-hydroxy-2-phenyl-1-benzofuran-5-carboxylic acid.
| Compound Name | 3-[1-[5-(benzylamino)-5-oxopentyl]triazol-4-yl]-6-hydroxy-2-phenyl-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 46868024 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-[1-[5-(benzylamino)-5-oxopentyl]triazol-4-yl]-6-hydroxy-2-phenyl-1-benzofuran-5-carboxylic acid |
| SMILES | O=C(CCCCn1cc(-c2c(-c3ccccc3)oc3cc(O)c(C(=O)O)cc23)nn1)NCc1ccccc1 |
| InChI | InChI=1S/C29H26N4O5/c34-24-16-25-22(15-21(24)29(36)37)27(28(38-25)20-11-5-2-6-12-20)23-18-33(32-31-23)14-8-7-13-26(35)30-17-19-9-3-1-4-10-19/h1-6,9-12,15-16,18,34H,7-8,13-14,17H2,(H,30,35)(H,36,37) |
| InChIKey | ZSLDORAHCINDJJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|