C11H12N2O3S — CID 46870654
N,2-dimethyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 46870654) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is N,2-dimethyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N,2-dimethyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 46870654 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N,2-dimethyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CNC(=O)C1=Cc2ccccc2S(=O)(=O)N1C |
| InChI | InChI=1S/C11H12N2O3S/c1-12-11(14)9-7-8-5-3-4-6-10(8)17(15,16)13(9)2/h3-7H,1-2H3,(H,12,14) |
| InChIKey | NUOZJGOQDVJCEJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |