C18H19Cl2N3O5 — CID 4687110
[2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 4687110) has the molecular formula C18H19Cl2N3O5 and a molecular weight of 428.27 g/mol. Its IUPAC name is [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 4687110 |
| Molecular Formula | C18H19Cl2N3O5 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | Cc1nc(NC(=O)COC(=O)CN2C(=O)C3CCCCC3C2=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O5/c1-9-12(19)6-13(20)16(21-9)22-14(24)8-28-15(25)7-23-17(26)10-4-2-3-5-11(10)18(23)27/h6,10-11H,2-5,7-8H2,1H3,(H,21,22,24) |
| InChIKey | GRKHVOCJLFLLAY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|