C19H21Cl2N3O5 — CID 6597925
[2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (2R)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 6597925) has the molecular formula C19H21Cl2N3O5 and a molecular weight of 442.30 g/mol. Its IUPAC name is [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (2R)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (2R)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 6597925 |
| Molecular Formula | C19H21Cl2N3O5 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [2-[(3,5-dichloro-6-methyl-2-pyridinyl)amino]-2-oxoethyl] (2R)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | Cc1nc(NC(=O)COC(=O)[C@@H](C)N2C(=O)[C@H]3CCCC[C@@H]3C2=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O5/c1-9-13(20)7-14(21)16(22-9)23-15(25)8-29-19(28)10(2)24-17(26)11-5-3-4-6-12(11)18(24)27/h7,10-12H,3-6,8H2,1-2H3,(H,22,23,25)/t10-,11+,12+/m1/s1 |
| InChIKey | QUEFMKBLBYENJA-WOPDTQHZSA-N |
| XLogP | 2.74 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|