C18H20ClN3O5 — CID 7572669
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (2S)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 7572669) has the molecular formula C18H20ClN3O5 and a molecular weight of 393.83 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (2S)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (2S)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 7572669 |
| Molecular Formula | C18H20ClN3O5 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] (2S)-2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)Nc1ccc(Cl)cn1)N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C18H20ClN3O5/c1-10(22-16(24)12-4-2-3-5-13(12)17(22)25)18(26)27-9-15(23)21-14-7-6-11(19)8-20-14/h6-8,10,12-13H,2-5,9H2,1H3,(H,20,21,23)/t10-,12-,13+/m0/s1 |
| InChIKey | AHCGJNCSFNUVGN-WCFLWFBJSA-N |
| XLogP | 1.78 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|