C22H16N4O2Se — CID 46871677
methyl N,N'-bis(quinoline-3-carbonyl)carbamimidoselenoate (PubChem CID 46871677) has the molecular formula C22H16N4O2Se and a molecular weight of 447.36 g/mol. Its IUPAC name is methyl N,N'-bis(quinoline-3-carbonyl)carbamimidoselenoate.
| Compound Name | methyl N,N'-bis(quinoline-3-carbonyl)carbamimidoselenoate |
|---|---|
| PubChem CID | 46871677 |
| Molecular Formula | C22H16N4O2Se |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | methyl N,N'-bis(quinoline-3-carbonyl)carbamimidoselenoate |
| SMILES | C[Se]/C(=N\C(=O)c1cnc2ccccc2c1)NC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C22H16N4O2Se/c1-29-22(25-20(27)16-10-14-6-2-4-8-18(14)23-12-16)26-21(28)17-11-15-7-3-5-9-19(15)24-13-17/h2-13H,1H3,(H,25,26,27,28) |
| InChIKey | UXKLQFHIHIOUDE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|