C15H22O3 — CID 46872583
(6S,6aS,9aR)-9a-hydroxy-6,8,8-trimethyl-4,5,6,6a,7,9-hexahydro-1H-azuleno[4,5-c]furan-3-one (PubChem CID 46872583) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (6S,6aS,9aR)-9a-hydroxy-6,8,8-trimethyl-4,5,6,6a,7,9-hexahydro-1H-azuleno[4,5-c]furan-3-one.
| Compound Name | (6S,6aS,9aR)-9a-hydroxy-6,8,8-trimethyl-4,5,6,6a,7,9-hexahydro-1H-azuleno[4,5-c]furan-3-one |
|---|---|
| PubChem CID | 46872583 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (6S,6aS,9aR)-9a-hydroxy-6,8,8-trimethyl-4,5,6,6a,7,9-hexahydro-1H-azuleno[4,5-c]furan-3-one |
| SMILES | C[C@H]1CCC2=C(COC2=O)[C@@]2(O)CC(C)(C)C[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-9-4-5-10-12(7-18-13(10)16)15(17)8-14(2,3)6-11(9)15/h9,11,17H,4-8H2,1-3H3/t9-,11-,15+/m0/s1 |
| InChIKey | VNDGSRHWEWETAM-CCUNJIBTSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |