C15H22N4O3 — CID 46873575
3-(4-methylpiperazin-1-yl)-2-(phenylcarbamoylamino)propanoic acid (PubChem CID 46873575) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-2-(phenylcarbamoylamino)propanoic acid.
| Compound Name | 3-(4-methylpiperazin-1-yl)-2-(phenylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 46873575 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-2-(phenylcarbamoylamino)propanoic acid |
| SMILES | CN1CCN(CC(NC(=O)Nc2ccccc2)C(=O)O)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-18-7-9-19(10-8-18)11-13(14(20)21)17-15(22)16-12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,20,21)(H2,16,17,22) |
| InChIKey | HOEMFLBVODACTP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |