C17H25NO3S — CID 46880557
(1R,5S)-8-(4-tert-butylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 46880557) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (1R,5S)-8-(4-tert-butylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,5S)-8-(4-tert-butylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 46880557 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (1R,5S)-8-(4-tert-butylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2[C@@H]3CC[C@H]2CC(O)C3)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-17(2,3)12-4-8-16(9-5-12)22(20,21)18-13-6-7-14(18)11-15(19)10-13/h4-5,8-9,13-15,19H,6-7,10-11H2,1-3H3/t13-,14+,15? |
| InChIKey | DJLICOBFOFJIQN-YIONKMFJSA-N |
| XLogP | 2.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |