C18H27NO3S — CID 25192695
8-(4-tert-butylphenyl)sulfonyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 25192695) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 8-(4-tert-butylphenyl)sulfonyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-(4-tert-butylphenyl)sulfonyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 25192695 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 8-(4-tert-butylphenyl)sulfonyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CC1(O)CC2CCC(C1)N2S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO3S/c1-17(2,3)13-5-9-16(10-6-13)23(21,22)19-14-7-8-15(19)12-18(4,20)11-14/h5-6,9-10,14-15,20H,7-8,11-12H2,1-4H3 |
| InChIKey | CMHFYZGPGKKQOM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |