C20H24N6O2 — CID 46881653
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide (PubChem CID 46881653) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 46881653 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
| SMILES | Cc1nc(CC(=O)Nc2ccc(CCNC[C@H](O)c3cccnc3)cc2)n[nH]1 |
| InChI | InChI=1S/C20H24N6O2/c1-14-23-19(26-25-14)11-20(28)24-17-6-4-15(5-7-17)8-10-22-13-18(27)16-3-2-9-21-12-16/h2-7,9,12,18,22,27H,8,10-11,13H2,1H3,(H,24,28)(H,23,25,26)/t18-/m0/s1 |
| InChIKey | UBDGGBIFKXIMIP-SFHVURJKSA-N |
| XLogP | 1.56 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|