C19H21FN2S — CID 46884119
2-[3-[1-(6-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine (PubChem CID 46884119) has the molecular formula C19H21FN2S and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[3-[1-(6-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[3-[1-(6-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 46884119 |
| Molecular Formula | C19H21FN2S |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-[3-[1-(6-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine |
| SMILES | CC(c1cccc(F)n1)c1c(CCN(C)C)sc2ccccc12 |
| InChI | InChI=1S/C19H21FN2S/c1-13(15-8-6-10-18(20)21-15)19-14-7-4-5-9-16(14)23-17(19)11-12-22(2)3/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | WIKAXVDAJYMGCT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|