C25H23N3OS — CID 46886146
3-benzyl-2-methylsulfanyl-6-[[(E)-3-phenylprop-2-enyl]amino]quinazolin-4-one (PubChem CID 46886146) has the molecular formula C25H23N3OS and a molecular weight of 413.55 g/mol. Its IUPAC name is 3-benzyl-2-methylsulfanyl-6-[[(E)-3-phenylprop-2-enyl]amino]quinazolin-4-one.
| Compound Name | 3-benzyl-2-methylsulfanyl-6-[[(E)-3-phenylprop-2-enyl]amino]quinazolin-4-one |
|---|---|
| PubChem CID | 46886146 |
| Molecular Formula | C25H23N3OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3-benzyl-2-methylsulfanyl-6-[[(E)-3-phenylprop-2-enyl]amino]quinazolin-4-one |
| SMILES | CSc1nc2ccc(NC/C=C/c3ccccc3)cc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H23N3OS/c1-30-25-27-23-15-14-21(26-16-8-13-19-9-4-2-5-10-19)17-22(23)24(29)28(25)18-20-11-6-3-7-12-20/h2-15,17,26H,16,18H2,1H3/b13-8+ |
| InChIKey | VMIJGQFUANOIAC-MDWZMJQESA-N |
| XLogP | 5.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |