C17H21N3O4 — CID 46886612
[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)morpholin-4-yl]-(3-nitrophenyl)methanone (PubChem CID 46886612) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)morpholin-4-yl]-(3-nitrophenyl)methanone.
| Compound Name | [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)morpholin-4-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46886612 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)morpholin-4-yl]-(3-nitrophenyl)methanone |
| SMILES | CN1CCC=C(C2CN(C(=O)c3cccc([N+](=O)[O-])c3)CCO2)C1 |
| InChI | InChI=1S/C17H21N3O4/c1-18-7-3-5-14(11-18)16-12-19(8-9-24-16)17(21)13-4-2-6-15(10-13)20(22)23/h2,4-6,10,16H,3,7-9,11-12H2,1H3 |
| InChIKey | OEBDRQPQNSAAMB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|