C18H26O5 — CID 46887315
methyl (6S)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-6,10-dimethylundec-9-en-2-ynoate (PubChem CID 46887315) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is methyl (6S)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-6,10-dimethylundec-9-en-2-ynoate.
| Compound Name | methyl (6S)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-6,10-dimethylundec-9-en-2-ynoate |
|---|---|
| PubChem CID | 46887315 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl (6S)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-6,10-dimethylundec-9-en-2-ynoate |
| SMILES | COC(=O)C#CC(C[C@@H](C)CCC=C(C)C)O/C=C/C(=O)OC |
| InChI | InChI=1S/C18H26O5/c1-14(2)7-6-8-15(3)13-16(9-10-17(19)21-4)23-12-11-18(20)22-5/h7,11-12,15-16H,6,8,13H2,1-5H3/b12-11+/t15-,16?/m0/s1 |
| InChIKey | GVTDFVUSRCCIDC-XCSCUOHVSA-N |
| XLogP | 3.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|