C45H54O7 — CID 46889164
(2R,3R,4S,5R,6S)-5-(4-cyclohexyloxyphenoxy)-2-[(4-cyclohexylphenoxy)methyl]-6-methoxy-3,4-bis(phenylmethoxy)oxane (PubChem CID 46889164) has the molecular formula C45H54O7 and a molecular weight of 706.92 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-5-(4-cyclohexyloxyphenoxy)-2-[(4-cyclohexylphenoxy)methyl]-6-methoxy-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6S)-5-(4-cyclohexyloxyphenoxy)-2-[(4-cyclohexylphenoxy)methyl]-6-methoxy-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 46889164 |
| Molecular Formula | C45H54O7 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 706.39 |
| IUPAC Name | (2R,3R,4S,5R,6S)-5-(4-cyclohexyloxyphenoxy)-2-[(4-cyclohexylphenoxy)methyl]-6-methoxy-3,4-bis(phenylmethoxy)oxane |
| SMILES | CO[C@H]1O[C@H](COc2ccc(C3CCCCC3)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1Oc1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C45H54O7/c1-46-45-44(51-40-28-26-39(27-29-40)50-38-20-12-5-13-21-38)43(49-31-34-16-8-3-9-17-34)42(48-30-33-14-6-2-7-15-33)41(52-45)32-47-37-24-22-36(23-25-37)35-18-10-4-11-19-35/h2-3,6-9,14-17,22-29,35,38,41-45H,4-5,10-13,18-21,30-32H2,1H3/t41-,42-,43+,44-,45+/m1/s1 |
| InChIKey | BUVAHUSPGKSSMT-NUFGPDMYSA-N |
| XLogP | 9.81 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |