C32H41N3O7 — CID 46891129
ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(4-methylbenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate (PubChem CID 46891129) has the molecular formula C32H41N3O7 and a molecular weight of 579.69 g/mol. Its IUPAC name is ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(4-methylbenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate.
| Compound Name | ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(4-methylbenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
|---|---|
| PubChem CID | 46891129 |
| Molecular Formula | C32H41N3O7 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(4-methylbenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(=O)C(COCc1ccccc1)NC(=O)[C@H](CC1CCCCC1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H41N3O7/c1-3-42-28(36)19-33-32(40)29(37)27(21-41-20-24-12-8-5-9-13-24)35-31(39)26(18-23-10-6-4-7-11-23)34-30(38)25-16-14-22(2)15-17-25/h5,8-9,12-17,23,26-27H,3-4,6-7,10-11,18-21H2,1-2H3,(H,33,40)(H,34,38)(H,35,39)/t26-,27?/m0/s1 |
| InChIKey | VEKLNYRHPODERA-QBHOUYDASA-N |
| XLogP | 3.01 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|