C27H22ClNO3 — CID 4689219
N-[3-chloro-4-(2-oxochromen-3-yl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 4689219) has the molecular formula C27H22ClNO3 and a molecular weight of 443.93 g/mol. Its IUPAC name is N-[3-chloro-4-(2-oxochromen-3-yl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | N-[3-chloro-4-(2-oxochromen-3-yl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4689219 |
| Molecular Formula | C27H22ClNO3 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[3-chloro-4-(2-oxochromen-3-yl)phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(C=CC(=O)Nc2ccc(-c3cc4ccccc4oc3=O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H22ClNO3/c1-17(2)19-10-7-18(8-11-19)9-14-26(30)29-21-12-13-22(24(28)16-21)23-15-20-5-3-4-6-25(20)32-27(23)31/h3-17H,1-2H3,(H,29,30) |
| InChIKey | RCXKVVKQXDYLEN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|