C25H17ClN2O5 — CID 17111521
(E)-3-(4-chloro-3-nitrophenyl)-N-[3-methyl-4-(2-oxochromen-3-yl)phenyl]prop-2-enamide (PubChem CID 17111521) has the molecular formula C25H17ClN2O5 and a molecular weight of 460.87 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-nitrophenyl)-N-[3-methyl-4-(2-oxochromen-3-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[3-methyl-4-(2-oxochromen-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17111521 |
| Molecular Formula | C25H17ClN2O5 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[3-methyl-4-(2-oxochromen-3-yl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)ccc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C25H17ClN2O5/c1-15-12-18(27-24(29)11-7-16-6-10-21(26)22(13-16)28(31)32)8-9-19(15)20-14-17-4-2-3-5-23(17)33-25(20)30/h2-14H,1H3,(H,27,29)/b11-7+ |
| InChIKey | BXKKBJMEJMAWIM-YRNVUSSQSA-N |
| XLogP | 5.98 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|