C36H51N5O6S — CID 46893236
1-N-[(2R)-1-[[(2S)-1-(2-methylpropylamino)-1-oxohexan-2-yl]amino]-3-phenylpropan-2-yl]-3-N,3-N-dipropyl-5-(1,1,3-trioxo-1,2-thiazol-5-yl)benzene-1,3-dicarboxamide (PubChem CID 46893236) has the molecular formula C36H51N5O6S and a molecular weight of 681.90 g/mol. Its IUPAC name is 1-N-[(2R)-1-[[(2S)-1-(2-methylpropylamino)-1-oxohexan-2-yl]amino]-3-phenylpropan-2-yl]-3-N,3-N-dipropyl-5-(1,1,3-trioxo-1,2-thiazol-5-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2R)-1-[[(2S)-1-(2-methylpropylamino)-1-oxohexan-2-yl]amino]-3-phenylpropan-2-yl]-3-N,3-N-dipropyl-5-(1,1,3-trioxo-1,2-thiazol-5-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46893236 |
| Molecular Formula | C36H51N5O6S |
| Molecular Weight | 681.90 g/mol |
| Exact Mass | 681.36 |
| IUPAC Name | 1-N-[(2R)-1-[[(2S)-1-(2-methylpropylamino)-1-oxohexan-2-yl]amino]-3-phenylpropan-2-yl]-3-N,3-N-dipropyl-5-(1,1,3-trioxo-1,2-thiazol-5-yl)benzene-1,3-dicarboxamide |
| SMILES | CCCC[C@H](NC[C@@H](Cc1ccccc1)NC(=O)c1cc(C(=O)N(CCC)CCC)cc(C2=CC(=O)NS2(=O)=O)c1)C(=O)NCC(C)C |
| InChI | InChI=1S/C36H51N5O6S/c1-6-9-15-31(35(44)38-23-25(4)5)37-24-30(18-26-13-11-10-12-14-26)39-34(43)28-19-27(32-22-33(42)40-48(32,46)47)20-29(21-28)36(45)41(16-7-2)17-8-3/h10-14,19-22,25,30-31,37H,6-9,15-18,23-24H2,1-5H3,(H,38,44)(H,39,43)(H,40,42)/t30-,31+/m1/s1 |
| InChIKey | CZESOQSGVICABK-JSOSNVBQSA-N |
| XLogP | 4.01 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |