C36H47N3O3 — CID 173156754
1-N-[(2R)-5-anilino-4-methyl-5-oxo-1-phenylpentan-2-yl]-3-N,3-N-dipentylbenzene-1,3-dicarboxamide (PubChem CID 173156754) has the molecular formula C36H47N3O3 and a molecular weight of 569.79 g/mol. Its IUPAC name is 1-N-[(2R)-5-anilino-4-methyl-5-oxo-1-phenylpentan-2-yl]-3-N,3-N-dipentylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2R)-5-anilino-4-methyl-5-oxo-1-phenylpentan-2-yl]-3-N,3-N-dipentylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 173156754 |
| Molecular Formula | C36H47N3O3 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.36 |
| IUPAC Name | 1-N-[(2R)-5-anilino-4-methyl-5-oxo-1-phenylpentan-2-yl]-3-N,3-N-dipentylbenzene-1,3-dicarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2ccccc2)CC(C)C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C36H47N3O3/c1-4-6-14-23-39(24-15-7-5-2)36(42)31-20-16-19-30(27-31)35(41)38-33(26-29-17-10-8-11-18-29)25-28(3)34(40)37-32-21-12-9-13-22-32/h8-13,16-22,27-28,33H,4-7,14-15,23-26H2,1-3H3,(H,37,40)(H,38,41)/t28?,33-/m1/s1 |
| InChIKey | FRQYPQNTTKUNLM-ZBAKNJOASA-N |
| XLogP | 7.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|