C29H42N3O5P — CID 91575328
(3-anilino-2-methyl-3-oxopropyl)-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-3-methylbutyl]phosphinic acid (PubChem CID 91575328) has the molecular formula C29H42N3O5P and a molecular weight of 543.65 g/mol. Its IUPAC name is (3-anilino-2-methyl-3-oxopropyl)-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-3-methylbutyl]phosphinic acid.
| Compound Name | (3-anilino-2-methyl-3-oxopropyl)-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-3-methylbutyl]phosphinic acid |
|---|---|
| PubChem CID | 91575328 |
| Molecular Formula | C29H42N3O5P |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | (3-anilino-2-methyl-3-oxopropyl)-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-3-methylbutyl]phosphinic acid |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)NC(CC(C)C)P(=O)(O)CC(C)C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C29H42N3O5P/c1-6-16-32(17-7-2)29(35)24-13-11-12-23(19-24)28(34)31-26(18-21(3)4)38(36,37)20-22(5)27(33)30-25-14-9-8-10-15-25/h8-15,19,21-22,26H,6-7,16-18,20H2,1-5H3,(H,30,33)(H,31,34)(H,36,37) |
| InChIKey | HXJJLYKOWAGXBS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|