C36H48N3O5P — CID 67321927
[3-(4-tert-butylanilino)-2-methyl-3-oxopropyl]-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-phenylethyl]phosphinic acid (PubChem CID 67321927) has the molecular formula C36H48N3O5P and a molecular weight of 633.77 g/mol. Its IUPAC name is [3-(4-tert-butylanilino)-2-methyl-3-oxopropyl]-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-phenylethyl]phosphinic acid.
| Compound Name | [3-(4-tert-butylanilino)-2-methyl-3-oxopropyl]-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-phenylethyl]phosphinic acid |
|---|---|
| PubChem CID | 67321927 |
| Molecular Formula | C36H48N3O5P |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | [3-(4-tert-butylanilino)-2-methyl-3-oxopropyl]-[1-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-phenylethyl]phosphinic acid |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)NC(Cc2ccccc2)P(=O)(O)CC(C)C(=O)Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C36H48N3O5P/c1-7-21-39(22-8-2)35(42)29-16-12-15-28(24-29)34(41)38-32(23-27-13-10-9-11-14-27)45(43,44)25-26(3)33(40)37-31-19-17-30(18-20-31)36(4,5)6/h9-20,24,26,32H,7-8,21-23,25H2,1-6H3,(H,37,40)(H,38,41)(H,43,44) |
| InChIKey | RPHXPNQWLNDHIQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|