C26H29N2O5P — CID 90725220
(3-anilino-2-methyl-3-oxopropyl)-[(1R)-1-[(3-hydroxy-2-methylbenzoyl)amino]-2-phenylethyl]phosphinic acid (PubChem CID 90725220) has the molecular formula C26H29N2O5P and a molecular weight of 480.50 g/mol. Its IUPAC name is (3-anilino-2-methyl-3-oxopropyl)-[(1R)-1-[(3-hydroxy-2-methylbenzoyl)amino]-2-phenylethyl]phosphinic acid.
| Compound Name | (3-anilino-2-methyl-3-oxopropyl)-[(1R)-1-[(3-hydroxy-2-methylbenzoyl)amino]-2-phenylethyl]phosphinic acid |
|---|---|
| PubChem CID | 90725220 |
| Molecular Formula | C26H29N2O5P |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (3-anilino-2-methyl-3-oxopropyl)-[(1R)-1-[(3-hydroxy-2-methylbenzoyl)amino]-2-phenylethyl]phosphinic acid |
| SMILES | Cc1c(O)cccc1C(=O)N[C@@H](Cc1ccccc1)P(=O)(O)CC(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H29N2O5P/c1-18(25(30)27-21-12-7-4-8-13-21)17-34(32,33)24(16-20-10-5-3-6-11-20)28-26(31)22-14-9-15-23(29)19(22)2/h3-15,18,24,29H,16-17H2,1-2H3,(H,27,30)(H,28,31)(H,32,33)/t18?,24-/m1/s1 |
| InChIKey | MOKMDQKBSGBJLE-VCUSLETLSA-N |
| XLogP | 4.54 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|