C21H18FN5O2 — CID 46893654
[4-[(5-ethyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluoro-3-methoxyphenyl)methanone (PubChem CID 46893654) has the molecular formula C21H18FN5O2 and a molecular weight of 391.41 g/mol. Its IUPAC name is [4-[(5-ethyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluoro-3-methoxyphenyl)methanone.
| Compound Name | [4-[(5-ethyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 46893654 |
| Molecular Formula | C21H18FN5O2 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [4-[(5-ethyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluoro-3-methoxyphenyl)methanone |
| SMILES | CCc1cc(Nc2nc(C(=O)c3ccc(F)c(OC)c3)nc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C21H18FN5O2/c1-3-13-11-18(27-26-13)24-20-14-6-4-5-7-16(14)23-21(25-20)19(28)12-8-9-15(22)17(10-12)29-2/h4-11H,3H2,1-2H3,(H2,23,24,25,26,27) |
| InChIKey | NTCQNKICUYFPQA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |