C20H18FN5 — CID 91262497
N-(5-ethyl-1H-pyrazol-3-yl)-2-[(4-fluorophenyl)methyl]quinazolin-4-amine (PubChem CID 91262497) has the molecular formula C20H18FN5 and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(5-ethyl-1H-pyrazol-3-yl)-2-[(4-fluorophenyl)methyl]quinazolin-4-amine.
| Compound Name | N-(5-ethyl-1H-pyrazol-3-yl)-2-[(4-fluorophenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 91262497 |
| Molecular Formula | C20H18FN5 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-(5-ethyl-1H-pyrazol-3-yl)-2-[(4-fluorophenyl)methyl]quinazolin-4-amine |
| SMILES | CCc1cc(Nc2nc(Cc3ccc(F)cc3)nc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C20H18FN5/c1-2-15-12-19(26-25-15)24-20-16-5-3-4-6-17(16)22-18(23-20)11-13-7-9-14(21)10-8-13/h3-10,12H,2,11H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | KWNXBNGSGFNBHG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |