C27H30N2O2Se — CID 46895631
(2S)-N-[(2R)-3-benzylselanyl-1-hydroxy-1,1-diphenylpropan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 46895631) has the molecular formula C27H30N2O2Se and a molecular weight of 493.51 g/mol. Its IUPAC name is (2S)-N-[(2R)-3-benzylselanyl-1-hydroxy-1,1-diphenylpropan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-3-benzylselanyl-1-hydroxy-1,1-diphenylpropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46895631 |
| Molecular Formula | C27H30N2O2Se |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (2S)-N-[(2R)-3-benzylselanyl-1-hydroxy-1,1-diphenylpropan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(N[C@@H](C[Se]Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C27H30N2O2Se/c30-26(24-17-10-18-28-24)29-25(20-32-19-21-11-4-1-5-12-21)27(31,22-13-6-2-7-14-22)23-15-8-3-9-16-23/h1-9,11-16,24-25,28,31H,10,17-20H2,(H,29,30)/t24-,25-/m0/s1 |
| InChIKey | FIFFEINXLVCTCQ-DQEYMECFSA-N |
| XLogP | 3.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|