C22H24ClFN4O — CID 46898555
[1-[(2S)-2-aminopropyl]-6-chloroindol-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 46898555) has the molecular formula C22H24ClFN4O and a molecular weight of 414.91 g/mol. Its IUPAC name is [1-[(2S)-2-aminopropyl]-6-chloroindol-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-[(2S)-2-aminopropyl]-6-chloroindol-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46898555 |
| Molecular Formula | C22H24ClFN4O |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [1-[(2S)-2-aminopropyl]-6-chloroindol-3-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | C[C@H](N)Cn1cc(C(=O)N2CCN(c3ccccc3F)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H24ClFN4O/c1-15(25)13-28-14-18(17-7-6-16(23)12-21(17)28)22(29)27-10-8-26(9-11-27)20-5-3-2-4-19(20)24/h2-7,12,14-15H,8-11,13,25H2,1H3/t15-/m0/s1 |
| InChIKey | HYEFXWSSMYXEPA-HNNXBMFYSA-N |
| XLogP | 3.74 |
| TPSA | 54.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |