C18H36N2Si2 — CID 46900328
(Z)-6-pyrrolidin-1-yl-2,3-bis(trimethylsilylmethyl)hex-2-enenitrile (PubChem CID 46900328) has the molecular formula C18H36N2Si2 and a molecular weight of 336.67 g/mol. Its IUPAC name is (Z)-6-pyrrolidin-1-yl-2,3-bis(trimethylsilylmethyl)hex-2-enenitrile.
| Compound Name | (Z)-6-pyrrolidin-1-yl-2,3-bis(trimethylsilylmethyl)hex-2-enenitrile |
|---|---|
| PubChem CID | 46900328 |
| Molecular Formula | C18H36N2Si2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | (Z)-6-pyrrolidin-1-yl-2,3-bis(trimethylsilylmethyl)hex-2-enenitrile |
| SMILES | C[Si](C)(C)C/C(C#N)=C(/CCCN1CCCC1)C[Si](C)(C)C |
| InChI | InChI=1S/C18H36N2Si2/c1-21(2,3)15-17(18(14-19)16-22(4,5)6)10-9-13-20-11-7-8-12-20/h7-13,15-16H2,1-6H3/b18-17- |
| InChIKey | LXKZFEWODUIZIA-ZCXUNETKSA-N |
| XLogP | 5.36 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|