C22H19ClN2O2 — CID 46901130
butyl 9-chloro-5-phenylpyrazolo[5,1-a]isoquinoline-1-carboxylate (PubChem CID 46901130) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is butyl 9-chloro-5-phenylpyrazolo[5,1-a]isoquinoline-1-carboxylate.
| Compound Name | butyl 9-chloro-5-phenylpyrazolo[5,1-a]isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 46901130 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | butyl 9-chloro-5-phenylpyrazolo[5,1-a]isoquinoline-1-carboxylate |
| SMILES | CCCCOC(=O)c1cnn2c(-c3ccccc3)cc3ccc(Cl)cc3c12 |
| InChI | InChI=1S/C22H19ClN2O2/c1-2-3-11-27-22(26)19-14-24-25-20(15-7-5-4-6-8-15)12-16-9-10-17(23)13-18(16)21(19)25/h4-10,12-14H,2-3,11H2,1H3 |
| InChIKey | ZXLVKNXJZWEPHA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|