C19H25N3O3S2 — CID 4690203
N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylacetamide (PubChem CID 4690203) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylacetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 4690203 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylacetamide |
| SMILES | CCOCCn1/c(=N/C(=O)CSCC(=O)N2CCCC2)sc2ccccc21 |
| InChI | InChI=1S/C19H25N3O3S2/c1-2-25-12-11-22-15-7-3-4-8-16(15)27-19(22)20-17(23)13-26-14-18(24)21-9-5-6-10-21/h3-4,7-8H,2,5-6,9-14H2,1H3/b20-19- |
| InChIKey | RVHNAXTXBUZFDP-VXPUYCOJSA-N |
| XLogP | 2.52 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|