C28H36N4O4 — CID 46902528
[1-[(2R,4R,5R)-1-hexyl-5-hydroxy-2-(4-methoxyphenyl)piperidin-4-yl]triazol-4-yl]methyl benzoate (PubChem CID 46902528) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is [1-[(2R,4R,5R)-1-hexyl-5-hydroxy-2-(4-methoxyphenyl)piperidin-4-yl]triazol-4-yl]methyl benzoate.
| Compound Name | [1-[(2R,4R,5R)-1-hexyl-5-hydroxy-2-(4-methoxyphenyl)piperidin-4-yl]triazol-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 46902528 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [1-[(2R,4R,5R)-1-hexyl-5-hydroxy-2-(4-methoxyphenyl)piperidin-4-yl]triazol-4-yl]methyl benzoate |
| SMILES | CCCCCCN1C[C@@H](O)[C@H](n2cc(COC(=O)c3ccccc3)nn2)C[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H36N4O4/c1-3-4-5-9-16-31-19-27(33)26(17-25(31)21-12-14-24(35-2)15-13-21)32-18-23(29-30-32)20-36-28(34)22-10-7-6-8-11-22/h6-8,10-15,18,25-27,33H,3-5,9,16-17,19-20H2,1-2H3/t25-,26-,27-/m1/s1 |
| InChIKey | YPNRIIBBYDVVFB-ZONZVBGPSA-N |
| XLogP | 4.57 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|